C13H13F3N3O4S- — CID 159005082
[(2S)-1-(cyanomethylamino)-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]azanide (PubChem CID 159005082) has the molecular formula C13H13F3N3O4S- and a molecular weight of 364.33 g/mol. Its IUPAC name is [(2S)-1-(cyanomethylamino)-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]azanide.
| Compound Name | [(2S)-1-(cyanomethylamino)-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]azanide |
|---|---|
| PubChem CID | 159005082 |
| Molecular Formula | C13H13F3N3O4S- |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [(2S)-1-(cyanomethylamino)-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]azanide |
| SMILES | N#CCNC(=O)[C@@H]([NH-])CCS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N3O4S/c14-13(15,16)23-9-1-3-10(4-2-9)24(21,22)8-5-11(18)12(20)19-7-6-17/h1-4,11,18H,5,7-8H2,(H,19,20)/q-1/t11-/m0/s1 |
| InChIKey | JRUZDJFKAOHVGB-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|