C27H34O3S2 — CID 15907654
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R)-2-methylsulfanylcarbothioyloxy-2-phenylpropanoate (PubChem CID 15907654) has the molecular formula C27H34O3S2 and a molecular weight of 470.70 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R)-2-methylsulfanylcarbothioyloxy-2-phenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R)-2-methylsulfanylcarbothioyloxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 15907654 |
| Molecular Formula | C27H34O3S2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R)-2-methylsulfanylcarbothioyloxy-2-phenylpropanoate |
| SMILES | CSC(=S)O[C@@](C)(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O3S2/c1-19-16-17-22(26(2,3)20-12-8-6-9-13-20)23(18-19)29-24(28)27(4,30-25(31)32-5)21-14-10-7-11-15-21/h6-15,19,22-23H,16-18H2,1-5H3/t19-,22-,23-,27-/m1/s1 |
| InChIKey | NICNCOHCEIIDKT-CPLTYXLBSA-N |
| XLogP | 6.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|