C17H14Cl2N6S2 — CID 159131353
7-chloro-1,3-benzothiazol-6-amine;7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-5-amine (PubChem CID 159131353) has the molecular formula C17H14Cl2N6S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 7-chloro-1,3-benzothiazol-6-amine;7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-5-amine.
| Compound Name | 7-chloro-1,3-benzothiazol-6-amine;7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 159131353 |
| Molecular Formula | C17H14Cl2N6S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 7-chloro-1,3-benzothiazol-6-amine;7-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-5-amine |
| SMILES | Clc1cc(NC2=NCCN2)cc2ncsc12.Nc1ccc2ncsc2c1Cl |
| InChI | InChI=1S/C10H9ClN4S.C7H5ClN2S/c11-7-3-6(15-10-12-1-2-13-10)4-8-9(7)16-5-14-8;8-6-4(9)1-2-5-7(6)11-3-10-5/h3-5H,1-2H2,(H2,12,13,15);1-3H,9H2 |
| InChIKey | KGXYPHIHFNFKIH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|