C21H27N7O4S — CID 159141233
N-[5-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2,5-dioxopentyl]-8-sulfanylquinoline-7-carboxamide (PubChem CID 159141233) has the molecular formula C21H27N7O4S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[5-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2,5-dioxopentyl]-8-sulfanylquinoline-7-carboxamide.
| Compound Name | N-[5-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2,5-dioxopentyl]-8-sulfanylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 159141233 |
| Molecular Formula | C21H27N7O4S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[5-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2,5-dioxopentyl]-8-sulfanylquinoline-7-carboxamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)CCC(=O)CNC(=O)c1ccc2cccnc2c1S |
| InChI | InChI=1S/C21H27N7O4S/c22-19(31)15(4-2-10-26-21(23)24)28-16(30)8-6-13(29)11-27-20(32)14-7-5-12-3-1-9-25-17(12)18(14)33/h1,3,5,7,9,15,33H,2,4,6,8,10-11H2,(H2,22,31)(H,27,32)(H,28,30)(H4,23,24,26)/t15-/m0/s1 |
| InChIKey | KICQTXNWWZNGSX-HNNXBMFYSA-N |
| XLogP | -0.37 |
| TPSA | 195.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|