C23H29F11O6 — CID 159146122
1-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-9-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-5,5-bis(prop-2-enyl)nonane-2,8-dione (PubChem CID 159146122) has the molecular formula C23H29F11O6 and a molecular weight of 610.46 g/mol. Its IUPAC name is 1-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-9-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-5,5-bis(prop-2-enyl)nonane-2,8-dione.
| Compound Name | 1-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-9-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-5,5-bis(prop-2-enyl)nonane-2,8-dione |
|---|---|
| PubChem CID | 159146122 |
| Molecular Formula | C23H29F11O6 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 1-[2-(1,1-difluoroethoxy)-2,2-difluoroethoxy]-9-[2,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-5,5-bis(prop-2-enyl)nonane-2,8-dione |
| SMILES | C=CCC(CC=C)(CCC(=O)COCC(F)(F)OC(C)(F)F)CCC(=O)COCC(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H29F11O6/c1-4-8-19(9-5-2,10-6-16(35)12-37-14-20(26,27)39-18(3,24)25)11-7-17(36)13-38-15-21(28,29)40-23(33,34)22(30,31)32/h4-5H,1-2,6-15H2,3H3 |
| InChIKey | SHGVOTJLOFIZRY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|