C20H20F18O2 — CID 159153738
(E)-1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene (PubChem CID 159153738) has the molecular formula C20H20F18O2 and a molecular weight of 634.34 g/mol. Its IUPAC name is (E)-1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene.
| Compound Name | (E)-1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene |
|---|---|
| PubChem CID | 159153738 |
| Molecular Formula | C20H20F18O2 |
| Molecular Weight | 634.34 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | (E)-1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1-trifluoropropan-2-yl)pent-2-ene |
| SMILES | CC(OCCO/C(=C(\C(C)C(F)(F)F)C(C)(F)C(F)(F)F)C(F)(F)F)=C(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C20H20F18O2/c1-8(16(24,25)26)10(13(3,21)18(30,31)32)12(17(27,28)29)40-7-6-39-9(2)11(14(4,22)19(33,34)35)15(5,23)20(36,37)38/h8H,6-7H2,1-5H3/b11-9?,12-10+ |
| InChIKey | KJPYNXXFMNXNGZ-UAMGIFDMSA-N |
| XLogP | 9.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.34 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|