C17H14N2OS — CID 159160128
1,3-benzothiazole;4-methyl-1H-quinolin-2-one (PubChem CID 159160128) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 1,3-benzothiazole;4-methyl-1H-quinolin-2-one.
| Compound Name | 1,3-benzothiazole;4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159160128 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1,3-benzothiazole;4-methyl-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2ccccc12.c1ccc2scnc2c1 |
| InChI | InChI=1S/C10H9NO.C7H5NS/c1-7-6-10(12)11-9-5-3-2-4-8(7)9;1-2-4-7-6(3-1)8-5-9-7/h2-6H,1H3,(H,11,12);1-5H |
| InChIKey | KKJOYFSGPGSSLC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |