C11H17Br3N2 — CID 159183164
(2-amino-3,5-dibromophenyl)methyl-(2-methylpropyl)azanium bromide (PubChem CID 159183164) has the molecular formula C11H17Br3N2 and a molecular weight of 416.98 g/mol. Its IUPAC name is (2-amino-3,5-dibromophenyl)methyl-(2-methylpropyl)azanium bromide.
| Compound Name | (2-amino-3,5-dibromophenyl)methyl-(2-methylpropyl)azanium bromide |
|---|---|
| PubChem CID | 159183164 |
| Molecular Formula | C11H17Br3N2 |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | (2-amino-3,5-dibromophenyl)methyl-(2-methylpropyl)azanium bromide |
| SMILES | CC(C)C[NH2+]Cc1cc(Br)cc(Br)c1N.[Br-] |
| InChI | InChI=1S/C11H16Br2N2.BrH/c1-7(2)5-15-6-8-3-9(12)4-10(13)11(8)14;/h3-4,7,15H,5-6,14H2,1-2H3;1H |
| InChIKey | KNDQIYUBRSOTRO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 42.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|