C14H20Br2N2 — CID 176836284
2,4-dibromo-6-[dideuterio-[methyl-(2,2,3,3,5,5,6,6-octadeuteriocyclohexyl)amino]methyl]aniline (PubChem CID 176836284) has the molecular formula C14H20Br2N2 and a molecular weight of 386.20 g/mol. Its IUPAC name is 2,4-dibromo-6-[dideuterio-[methyl-(2,2,3,3,5,5,6,6-octadeuteriocyclohexyl)amino]methyl]aniline.
| Compound Name | 2,4-dibromo-6-[dideuterio-[methyl-(2,2,3,3,5,5,6,6-octadeuteriocyclohexyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 176836284 |
| Molecular Formula | C14H20Br2N2 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2,4-dibromo-6-[dideuterio-[methyl-(2,2,3,3,5,5,6,6-octadeuteriocyclohexyl)amino]methyl]aniline |
| SMILES | [2H]C([2H])(c1cc(Br)cc(Br)c1N)N(C)C1C([2H])([2H])C([2H])([2H])CC([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3/i3D2,4D2,5D2,6D2,9D2 |
| InChIKey | OJGDCBLYJGHCIH-VMZLXYROSA-N |
| XLogP | 4.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|