C42H48O6 — CID 159253839
4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diol;1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 159253839) has the molecular formula C42H48O6 and a molecular weight of 648.84 g/mol. Its IUPAC name is 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diol;1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diol;1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 159253839 |
| Molecular Formula | C42H48O6 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diol;1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(O)cc32)c2cc(O)ccc21.CC1(C)CC2(CC(C)(C)c3ccc(O)cc3O2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C21H24O4.C21H24O2/c1-19(2)11-21(24-17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)25-21;1-19(2)11-21(17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)21/h5-10,22-23H,11-12H2,1-4H3;5-10,22-23H,11-12H2,1-4H3 |
| InChIKey | KVQGBNQAHZUIFU-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |