C25H29NO4 — CID 159268670
(8bS,14aS)-2,3,6,7-tetramethoxy-9,11,12,13,14,14a-hexahydro-8bH-phenanthro[9,10-b]quinolizine (PubChem CID 159268670) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (8bS,14aS)-2,3,6,7-tetramethoxy-9,11,12,13,14,14a-hexahydro-8bH-phenanthro[9,10-b]quinolizine.
| Compound Name | (8bS,14aS)-2,3,6,7-tetramethoxy-9,11,12,13,14,14a-hexahydro-8bH-phenanthro[9,10-b]quinolizine |
|---|---|
| PubChem CID | 159268670 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (8bS,14aS)-2,3,6,7-tetramethoxy-9,11,12,13,14,14a-hexahydro-8bH-phenanthro[9,10-b]quinolizine |
| SMILES | COc1cc2c(cc1OC)-c1cc(OC)c(OC)cc1[C@H]1CN3CCCC[C@H]3C=C21 |
| InChI | InChI=1S/C25H29NO4/c1-27-22-10-17-16-9-15-7-5-6-8-26(15)14-21(16)20-13-25(30-4)24(29-3)12-19(20)18(17)11-23(22)28-2/h9-13,15,21H,5-8,14H2,1-4H3/t15-,21-/m0/s1 |
| InChIKey | KXKULRKSUHFWLX-BTYIYWSLSA-N |
| XLogP | 4.74 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |