C13H24 — CID 159280610
2,8,9-trimethyldec-3-yne (PubChem CID 159280610) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 2,8,9-trimethyldec-3-yne.
| Compound Name | 2,8,9-trimethyldec-3-yne |
|---|---|
| PubChem CID | 159280610 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 2,8,9-trimethyldec-3-yne |
| SMILES | CC(C)C#CCCCC(C)C(C)C |
| InChI | InChI=1S/C13H24/c1-11(2)9-7-6-8-10-13(5)12(3)4/h11-13H,6,8,10H2,1-5H3 |
| InChIKey | MZFYBBFRPLVNFL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|