C30H41ClN2O9S — CID 159321450
N-[2-(3-chloropropylperoxy)ethyl]-N,2-dimethylprop-2-enamide;[4-[2-(4-methylphenyl)sulfonyloxyethoxymethylamino]phenyl] 2-methylprop-2-enoate (PubChem CID 159321450) has the molecular formula C30H41ClN2O9S and a molecular weight of 641.18 g/mol. Its IUPAC name is N-[2-(3-chloropropylperoxy)ethyl]-N,2-dimethylprop-2-enamide;[4-[2-(4-methylphenyl)sulfonyloxyethoxymethylamino]phenyl] 2-methylprop-2-enoate.
| Compound Name | N-[2-(3-chloropropylperoxy)ethyl]-N,2-dimethylprop-2-enamide;[4-[2-(4-methylphenyl)sulfonyloxyethoxymethylamino]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159321450 |
| Molecular Formula | C30H41ClN2O9S |
| Molecular Weight | 641.18 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | N-[2-(3-chloropropylperoxy)ethyl]-N,2-dimethylprop-2-enamide;[4-[2-(4-methylphenyl)sulfonyloxyethoxymethylamino]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)N(C)CCOOCCCCl.C=C(C)C(=O)Oc1ccc(NCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H23NO6S.C10H18ClNO3/c1-15(2)20(22)27-18-8-6-17(7-9-18)21-14-25-12-13-26-28(23,24)19-10-4-16(3)5-11-19;1-9(2)10(13)12(3)6-8-15-14-7-4-5-11/h4-11,21H,1,12-14H2,2-3H3;1,4-8H2,2-3H3 |
| InChIKey | LDUYEKFJPRVXJW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|