C10H14O3Se — CID 159327003
4-[(1S)-1-deuterio-1-protioethyl]seleninyl-1,2-dimethoxybenzene (PubChem CID 159327003) has the molecular formula C10H14O3Se and a molecular weight of 262.18 g/mol. Its IUPAC name is 4-[(1S)-1-deuterio-1-protioethyl]seleninyl-1,2-dimethoxybenzene.
| Compound Name | 4-[(1S)-1-deuterio-1-protioethyl]seleninyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 159327003 |
| Molecular Formula | C10H14O3Se |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 4-[(1S)-1-deuterio-1-protioethyl]seleninyl-1,2-dimethoxybenzene |
| SMILES | [1H][C@]([2H])(C)[Se](=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H14O3Se/c1-4-14(11)8-5-6-9(12-2)10(7-8)13-3/h5-7H,4H2,1-3H3/i4DH/t4-,14?/m0/s1 |
| InChIKey | DJZHNPYXMDTXMG-KOKPRMLUSA-N |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|