C17H21BrN6O3 — CID 159348416
N'-(3-bromo-4-methylphenyl)-N-hydroxy-4-[(4-imino-6-oxoheptyl)amino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159348416) has the molecular formula C17H21BrN6O3 and a molecular weight of 437.30 g/mol. Its IUPAC name is N'-(3-bromo-4-methylphenyl)-N-hydroxy-4-[(4-imino-6-oxoheptyl)amino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-methylphenyl)-N-hydroxy-4-[(4-imino-6-oxoheptyl)amino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159348416 |
| Molecular Formula | C17H21BrN6O3 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N'-(3-bromo-4-methylphenyl)-N-hydroxy-4-[(4-imino-6-oxoheptyl)amino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]/N=C(/CCCNc1nonc1/C(=N/c1ccc(C)c(Br)c1)NO)CC(C)=O |
| InChI | InChI=1S/C17H21BrN6O3/c1-10-5-6-13(9-14(10)18)21-17(22-26)15-16(24-27-23-15)20-7-3-4-12(19)8-11(2)25/h5-6,9,19,26H,3-4,7-8H2,1-2H3,(H,20,24)(H,21,22)/b19-12- |
| InChIKey | DJMUUKUCIFEFEA-UNOMPAQXSA-N |
| XLogP | 3.39 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|