C38H62N4O9 — CID 159366007
(4S)-4-[[(1S)-1-carboxy-5-[[2-ethyl-8-[(4-hydroxyphenyl)methylcarbamoyl]-4,4,10,10-tetramethylundecanoyl]amino]pentyl]carbamoylamino]-5-oxohexanoic acid (PubChem CID 159366007) has the molecular formula C38H62N4O9 and a molecular weight of 718.93 g/mol. Its IUPAC name is (4S)-4-[[(1S)-1-carboxy-5-[[2-ethyl-8-[(4-hydroxyphenyl)methylcarbamoyl]-4,4,10,10-tetramethylundecanoyl]amino]pentyl]carbamoylamino]-5-oxohexanoic acid.
| Compound Name | (4S)-4-[[(1S)-1-carboxy-5-[[2-ethyl-8-[(4-hydroxyphenyl)methylcarbamoyl]-4,4,10,10-tetramethylundecanoyl]amino]pentyl]carbamoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 159366007 |
| Molecular Formula | C38H62N4O9 |
| Molecular Weight | 718.93 g/mol |
| Exact Mass | 718.45 |
| IUPAC Name | (4S)-4-[[(1S)-1-carboxy-5-[[2-ethyl-8-[(4-hydroxyphenyl)methylcarbamoyl]-4,4,10,10-tetramethylundecanoyl]amino]pentyl]carbamoylamino]-5-oxohexanoic acid |
| SMILES | CCC(CC(C)(C)CCCC(CC(C)(C)C)C(=O)NCc1ccc(O)cc1)C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(C)=O)C(=O)O |
| InChI | InChI=1S/C38H62N4O9/c1-8-27(33(47)39-21-10-9-13-31(35(49)50)42-36(51)41-30(25(2)43)18-19-32(45)46)23-38(6,7)20-11-12-28(22-37(3,4)5)34(48)40-24-26-14-16-29(44)17-15-26/h14-17,27-28,30-31,44H,8-13,18-24H2,1-7H3,(H,39,47)(H,40,48)(H,45,46)(H,49,50)(H2,41,42,51)/t27?,28?,30-,31-/m0/s1 |
| InChIKey | WFYLJPVFIXTYKA-AAFCJBGOSA-N |
| XLogP | 5.53 |
| TPSA | 211.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|