C14H18N3O8P — CID 159381577
N-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphonamidic acid (PubChem CID 159381577) has the molecular formula C14H18N3O8P and a molecular weight of 387.29 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphonamidic acid.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphonamidic acid |
|---|---|
| PubChem CID | 159381577 |
| Molecular Formula | C14H18N3O8P |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphonamidic acid |
| SMILES | O=C(CCNP(=O)(O)CCCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H18N3O8P/c18-10-2-3-11(19)16(10)8-1-9-26(23,24)15-7-6-14(22)25-17-12(20)4-5-13(17)21/h2-3H,1,4-9H2,(H2,15,23,24) |
| InChIKey | HHHBKSOTTNRXKT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|