About boric acid;isocyanic acid;triethoxysilane
boric acid;isocyanic acid;triethoxysilane (PubChem CID 159384027) has the molecular formula C7H20BNO7Si
and a molecular weight of 269.13 g/mol. Its IUPAC name is boric acid;isocyanic acid;triethoxysilane.
Molecular Properties
| Compound Name | boric acid;isocyanic acid;triethoxysilane |
| PubChem CID | 159384027 |
| Molecular Formula | C7H20BNO7Si |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | boric acid;isocyanic acid;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.N=C=O.OB(O)O |
| InChI | InChI=1S/C6H16O3Si.CHNO.BH3O3/c1-4-7-10(8-5-2)9-6-3;2-1-3;2-1(3)4/h10H,4-6H2,1-3H3;2H;2-4H |
| InChIKey | LLGRHFVLNYFGMN-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze boric acid;isocyanic acid;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;isocyanic acid;triethoxysilane?
The IUPAC name of boric acid;isocyanic acid;triethoxysilane (CID 159384027) is boric acid;isocyanic acid;triethoxysilane.
What is the SMILES notation for boric acid;isocyanic acid;triethoxysilane?
The canonical SMILES for boric acid;isocyanic acid;triethoxysilane is CCO[SiH](OCC)OCC.N=C=O.OB(O)O.
What is the InChIKey of boric acid;isocyanic acid;triethoxysilane?
The InChIKey is LLGRHFVLNYFGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.CHNO.BH3O3/c1-4-7-10(8-5-2)9-6-3;2-1-3;2-1(3)4/h10H,4-6H2,1-3H3;2H;2-4H.
What are the key properties of boric acid;isocyanic acid;triethoxysilane?
boric acid;isocyanic acid;triethoxysilane has a molecular weight of 269.13 g/mol, XLogP of -1.34, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;isocyanic acid;triethoxysilane is sourced from PubChem (CID 159384027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).