C31H51NO7Si — CID 15940873
2-trimethylsilylethyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate (PubChem CID 15940873) has the molecular formula C31H51NO7Si and a molecular weight of 577.84 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate |
|---|---|
| PubChem CID | 15940873 |
| Molecular Formula | C31H51NO7Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2R,4S)-4-[(1R,2R,6R,8S,10S)-4-methoxy-10-methyl-8-(phenylmethoxymethyl)-3,7,12-trioxatricyclo[6.3.1.02,6]dodecan-4-yl]-2-methylpentyl]carbamate |
| SMILES | COC1([C@@H](C)C[C@@H](C)CNC(=O)OCC[Si](C)(C)C)C[C@H]2O[C@]3(COCc4ccccc4)C[C@@H](C)C[C@@H](O3)[C@H]2O1 |
| InChI | InChI=1S/C31H51NO7Si/c1-22-16-26-28-27(38-30(17-22,37-26)21-35-20-25-11-9-8-10-12-25)18-31(34-4,39-28)24(3)15-23(2)19-32-29(33)36-13-14-40(5,6)7/h8-12,22-24,26-28H,13-21H2,1-7H3,(H,32,33)/t22-,23+,24-,26+,27+,28+,30-,31?/m0/s1 |
| InChIKey | VFYWBBXYVNXAMP-IFQNOBHGSA-N |
| XLogP | 5.97 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|