C40H44N4O9 — CID 159564447
4-[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]-N-[2-[3-[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl]butanamide (PubChem CID 159564447) has the molecular formula C40H44N4O9 and a molecular weight of 724.81 g/mol. Its IUPAC name is 4-[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]-N-[2-[3-[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl]butanamide.
| Compound Name | 4-[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]-N-[2-[3-[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 159564447 |
| Molecular Formula | C40H44N4O9 |
| Molecular Weight | 724.81 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | 4-[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]-N-[2-[3-[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl]butanamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3c2ccn3C)cc(OC)c1CCCC(=O)NCCOCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C40H44N4O9/c1-42-16-14-27-31(23-43(2)40(50)37(27)42)25-20-34(51-3)29(35(21-25)52-4)8-5-9-36(47)41-15-18-53-17-6-7-24-10-12-28-30(19-24)39(49)44(38(28)48)32-13-11-26(45)22-33(32)46/h10,12,14,16,19-21,23,32H,5-9,11,13,15,17-18,22H2,1-4H3,(H,41,47) |
| InChIKey | LBVWVVYZBVXSGT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|