C55H80O3P2 — CID 159644264
[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;1-[5-methoxy-4-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one (PubChem CID 159644264) has the molecular formula C55H80O3P2 and a molecular weight of 851.19 g/mol. Its IUPAC name is [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;1-[5-methoxy-4-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one.
| Compound Name | [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;1-[5-methoxy-4-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
|---|---|
| PubChem CID | 159644264 |
| Molecular Formula | C55H80O3P2 |
| Molecular Weight | 851.19 g/mol |
| Exact Mass | 850.56 |
| IUPAC Name | [6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;1-[5-methoxy-4-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
| SMILES | COc1cc(P2C(C)(C)CC(=O)CC2(C)C)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1C.COc1ccc(C)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1P |
| InChI | InChI=1S/C32H47O2P.C23H33OP/c1-19(2)23-14-25(20(3)4)30(26(15-23)21(5)6)27-13-22(7)28(34-12)16-29(27)35-31(8,9)17-24(33)18-32(35,10)11;1-13(2)17-11-18(14(3)4)22(19(12-17)15(5)6)21-16(7)9-10-20(24-8)23(21)25/h13-16,19-21H,17-18H2,1-12H3;9-15H,25H2,1-8H3 |
| InChIKey | MQTGLPZXQRATOG-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.19 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|