C30H27F6N3O3 — CID 159700627
1,1,1,4,4,4-hexafluorobutane-2,3-dione;(11S,16R)-N-(3-phenylphenyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine (PubChem CID 159700627) has the molecular formula C30H27F6N3O3 and a molecular weight of 591.55 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;(11S,16R)-N-(3-phenylphenyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;(11S,16R)-N-(3-phenylphenyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
|---|---|
| PubChem CID | 159700627 |
| Molecular Formula | C30H27F6N3O3 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;(11S,16R)-N-(3-phenylphenyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.c1ccc(-c2cccc(Nc3cc4c5c(c3)[C@@H]3CNCC[C@@H]3N5CCOC4)c2)cc1 |
| InChI | InChI=1S/C26H27N3O.C4F6O2/c1-2-5-18(6-3-1)19-7-4-8-21(13-19)28-22-14-20-17-30-12-11-29-25-9-10-27-16-24(25)23(15-22)26(20)29;5-3(6,7)1(11)2(12)4(8,9)10/h1-8,13-15,24-25,27-28H,9-12,16-17H2;/t24-,25-;/m0./s1 |
| InChIKey | MXOOFTVKKGUSDW-DKIIUIKKSA-N |
| XLogP | 6.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|