C29H36N2O4Si — CID 159700939
1-[4-[tert-butyl(diphenyl)silyl]oxy-5-(1-hydroxyprop-2-enyl)oxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one (PubChem CID 159700939) has the molecular formula C29H36N2O4Si and a molecular weight of 504.70 g/mol. Its IUPAC name is 1-[4-[tert-butyl(diphenyl)silyl]oxy-5-(1-hydroxyprop-2-enyl)oxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one.
| Compound Name | 1-[4-[tert-butyl(diphenyl)silyl]oxy-5-(1-hydroxyprop-2-enyl)oxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 159700939 |
| Molecular Formula | C29H36N2O4Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[4-[tert-butyl(diphenyl)silyl]oxy-5-(1-hydroxyprop-2-enyl)oxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
| SMILES | C=CC(O)C1OC(N2C=C(C)C(=O)NC2=C)CC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36N2O4Si/c1-7-24(32)27-25(18-26(34-27)31-19-20(2)28(33)30-21(31)3)35-36(29(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h7-17,19,24-27,32H,1,3,18H2,2,4-6H3,(H,30,33) |
| InChIKey | MXPLZRWCZKUMIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|