C26H33IN2O4Si — CID 70229761
1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-iodo-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 70229761) has the molecular formula C26H33IN2O4Si and a molecular weight of 592.55 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-iodo-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-iodo-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 70229761 |
| Molecular Formula | C26H33IN2O4Si |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyloxolan-2-yl]-5-iodo-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@H]1O[C@@H](N2CC(C)(I)C(=O)NC2=O)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33IN2O4Si/c1-18-21(16-22(32-18)29-17-26(5,27)23(30)28-24(29)31)33-34(25(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18,21-22H,16-17H2,1-5H3,(H,28,30,31)/t18-,21+,22-,26?/m1/s1 |
| InChIKey | UPSNAGWYVLAACG-VBAGLBJESA-N |
| XLogP | 3.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|