C17H19F3O7S — CID 159732254
3,3,3-trifluoro-2-methyl-2-[(Z)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxypropane-1-sulfonic acid (PubChem CID 159732254) has the molecular formula C17H19F3O7S and a molecular weight of 424.39 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[(Z)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[(Z)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159732254 |
| Molecular Formula | C17H19F3O7S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[(Z)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
| SMILES | Cc1cc(C)c(OC(=O)/C=C\C(=O)OC(C)(CS(=O)(=O)O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C17H19F3O7S/c1-10-7-11(2)15(12(3)8-10)26-13(21)5-6-14(22)27-16(4,17(18,19)20)9-28(23,24)25/h5-8H,9H2,1-4H3,(H,23,24,25)/b6-5- |
| InChIKey | XUXWSZNIHNQVES-WAYWQWQTSA-N |
| XLogP | 2.83 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|