C12H18F6N2O7S3 — CID 159805189
bis(trifluoromethylsulfonyl)azanide;2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-3-ium (PubChem CID 159805189) has the molecular formula C12H18F6N2O7S3 and a molecular weight of 512.47 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 159805189 |
| Molecular Formula | C12H18F6N2O7S3 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-3-ium |
| SMILES | COCCOCCOCCc1[nH+]ccs1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17NO3S.C2F6NO4S2/c1-12-5-6-14-8-7-13-4-2-10-11-3-9-15-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3,9H,2,4-8H2,1H3;/q;-1/p+1 |
| InChIKey | NKHLVEGVJUEAFV-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 124.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|