C22H24ClN5O — CID 159838808
8-chloro-2-(2,2-dimethylpropyl)-3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]isoquinolin-1-one (PubChem CID 159838808) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 8-chloro-2-(2,2-dimethylpropyl)-3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-2-(2,2-dimethylpropyl)-3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 159838808 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 8-chloro-2-(2,2-dimethylpropyl)-3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]isoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(C)nc1N[C@@H](C)c1cc2cccc(Cl)c2c(=O)n1CC(C)(C)C |
| InChI | InChI=1S/C22H24ClN5O/c1-13(26-20-17(24-6)11-25-14(2)27-20)18-10-15-8-7-9-16(23)19(15)21(29)28(18)12-22(3,4)5/h7-11,13H,12H2,1-5H3,(H,25,26,27)/t13-/m0/s1 |
| InChIKey | LRLGFNXZQQVNQY-ZDUSSCGKSA-N |
| XLogP | 5.52 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|