C12H26N2O — CID 159924364
1,2-diamino-6-ethyl-8-methylnonan-3-one (PubChem CID 159924364) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,2-diamino-6-ethyl-8-methylnonan-3-one.
| Compound Name | 1,2-diamino-6-ethyl-8-methylnonan-3-one |
|---|---|
| PubChem CID | 159924364 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,2-diamino-6-ethyl-8-methylnonan-3-one |
| SMILES | CCC(CCC(=O)C(N)CN)CC(C)C |
| InChI | InChI=1S/C12H26N2O/c1-4-10(7-9(2)3)5-6-12(15)11(14)8-13/h9-11H,4-8,13-14H2,1-3H3 |
| InChIKey | QUPKAIFCSFPLHO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |