C21H16N2 — CID 159925465
2-pyridin-4-yl-1,3,6,11-tetrahydronaphtho[2,3-e]isoindol-2-ium-3-ide (PubChem CID 159925465) has the molecular formula C21H16N2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-pyridin-4-yl-1,3,6,11-tetrahydronaphtho[2,3-e]isoindol-2-ium-3-ide.
| Compound Name | 2-pyridin-4-yl-1,3,6,11-tetrahydronaphtho[2,3-e]isoindol-2-ium-3-ide |
|---|---|
| PubChem CID | 159925465 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-pyridin-4-yl-1,3,6,11-tetrahydronaphtho[2,3-e]isoindol-2-ium-3-ide |
| SMILES | [C-]1=[N+](c2ccncc2)Cc2c1ccc1c2Cc2ccccc2C1 |
| InChI | InChI=1S/C21H16N2/c1-2-4-16-12-20-17(11-15(16)3-1)5-6-18-13-23(14-21(18)20)19-7-9-22-10-8-19/h1-10H,11-12,14H2 |
| InChIKey | KBMQDLPKKZMIEX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|