C18H19ClN2O3 — CID 160540203
(4aS)-7a-(4-butoxyphenyl)-4-chloro-2-oxo-1,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile (PubChem CID 160540203) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (4aS)-7a-(4-butoxyphenyl)-4-chloro-2-oxo-1,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile.
| Compound Name | (4aS)-7a-(4-butoxyphenyl)-4-chloro-2-oxo-1,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 160540203 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (4aS)-7a-(4-butoxyphenyl)-4-chloro-2-oxo-1,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile |
| SMILES | CCCCOc1ccc(C23COC[C@H]2C(Cl)=C(C#N)C(=O)N3)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-2-3-8-24-13-6-4-12(5-7-13)18-11-23-10-15(18)16(19)14(9-20)17(22)21-18/h4-7,15H,2-3,8,10-11H2,1H3,(H,21,22)/t15-,18?/m0/s1 |
| InChIKey | ARZGTSPUMAPUHU-BUSXIPJBSA-N |
| XLogP | 2.85 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|