C35H49N5O10 — CID 160557657
(2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[10-(2,5-dioxopyrrol-1-yl)-2,8-dioxodecoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide (PubChem CID 160557657) has the molecular formula C35H49N5O10 and a molecular weight of 699.80 g/mol. Its IUPAC name is (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[10-(2,5-dioxopyrrol-1-yl)-2,8-dioxodecoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[10-(2,5-dioxopyrrol-1-yl)-2,8-dioxodecoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 160557657 |
| Molecular Formula | C35H49N5O10 |
| Molecular Weight | 699.80 g/mol |
| Exact Mass | 699.35 |
| IUPAC Name | (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[10-(2,5-dioxopyrrol-1-yl)-2,8-dioxodecoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide |
| SMILES | CC(=O)N[C@H](C(=O)C[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)c(OCC(=O)CCCCCC(=O)CCN2C(=O)C=CC2=O)c1)C(C)C |
| InChI | InChI=1S/C35H49N5O10/c1-22(2)33(38-23(3)42)29(45)18-24(8-7-16-37-35(36)49)34(48)39-26-12-11-25(20-41)30(19-26)50-21-28(44)10-6-4-5-9-27(43)15-17-40-31(46)13-14-32(40)47/h11-14,19,22,24,33,41H,4-10,15-18,20-21H2,1-3H3,(H,38,42)(H,39,48)(H3,36,37,49)/t24-,33+/m1/s1 |
| InChIKey | XBIZSBMHCKFNGJ-IANOAQMISA-N |
| XLogP | 2.08 |
| TPSA | 231.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|