C31H45N5O8 — CID 160656758
(2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[6-(2,5-dioxopyrrol-1-yl)hexoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide (PubChem CID 160656758) has the molecular formula C31H45N5O8 and a molecular weight of 615.73 g/mol. Its IUPAC name is (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[6-(2,5-dioxopyrrol-1-yl)hexoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[6-(2,5-dioxopyrrol-1-yl)hexoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 160656758 |
| Molecular Formula | C31H45N5O8 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | (2R,5S)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-[3-[6-(2,5-dioxopyrrol-1-yl)hexoxy]-4-(hydroxymethyl)phenyl]-6-methyl-4-oxoheptanamide |
| SMILES | CC(=O)N[C@H](C(=O)C[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)c(OCCCCCCN2C(=O)C=CC2=O)c1)C(C)C |
| InChI | InChI=1S/C31H45N5O8/c1-20(2)29(34-21(3)38)25(39)17-22(9-8-14-33-31(32)43)30(42)35-24-11-10-23(19-37)26(18-24)44-16-7-5-4-6-15-36-27(40)12-13-28(36)41/h10-13,18,20,22,29,37H,4-9,14-17,19H2,1-3H3,(H,34,38)(H,35,42)(H3,32,33,43)/t22-,29+/m1/s1 |
| InChIKey | ZKQCTVAYLHSBML-MNNSJKJDSA-N |
| XLogP | 2.17 |
| TPSA | 197.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|