About 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone
1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone (PubChem CID 160637935) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone.
Molecular Properties
| Compound Name | 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone |
| PubChem CID | 160637935 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.COCCOCC(C)N |
| InChI | InChI=1S/C8H8O.C6H15NO2/c1-7(9)8-5-3-2-4-6-8;1-6(7)5-9-4-3-8-2/h2-6H,1H3;6H,3-5,7H2,1-2H3 |
| InChIKey | RIUAXXHFEZCKNH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone?
The IUPAC name of 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone (CID 160637935) is 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone.
What is the SMILES notation for 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone?
The canonical SMILES for 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone is CC(=O)c1ccccc1.COCCOCC(C)N.
What is the InChIKey of 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone?
The InChIKey is RIUAXXHFEZCKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H15NO2/c1-7(9)8-5-3-2-4-6-8;1-6(7)5-9-4-3-8-2/h2-6H,1H3;6H,3-5,7H2,1-2H3.
What are the key properties of 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone?
1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone has a molecular weight of 253.34 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethoxy)propan-2-amine;1-phenylethanone is sourced from PubChem (CID 160637935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).