C32H47N5O3S — CID 160663675
tert-butyl (2S)-2-(3a,7a-dihydro-1,3-benzothiazol-2-ylamino)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoate (PubChem CID 160663675) has the molecular formula C32H47N5O3S and a molecular weight of 581.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3a,7a-dihydro-1,3-benzothiazol-2-ylamino)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-2-(3a,7a-dihydro-1,3-benzothiazol-2-ylamino)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoate |
|---|---|
| PubChem CID | 160663675 |
| Molecular Formula | C32H47N5O3S |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | tert-butyl (2S)-2-(3a,7a-dihydro-1,3-benzothiazol-2-ylamino)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoate |
| SMILES | CC(=O)NCCN(CCCCc1ccc2c(n1)CCCC2)CC[C@H](NC1=NC2C=CC=CC2S1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47N5O3S/c1-23(38)33-19-22-37(20-10-9-12-25-17-16-24-11-5-6-13-26(24)34-25)21-18-28(30(39)40-32(2,3)4)36-31-35-27-14-7-8-15-29(27)41-31/h7-8,14-17,27-29H,5-6,9-13,18-22H2,1-4H3,(H,33,38)(H,35,36)/t27?,28-,29?/m0/s1 |
| InChIKey | ZWDYLPAMXUBPEN-VJPAEBCTSA-N |
| XLogP | 4.38 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|