C30H41N5O3 — CID 157482257
(2R)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)methyl]butanoic acid (PubChem CID 157482257) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is (2R)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)methyl]butanoic acid.
| Compound Name | (2R)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 157482257 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | (2R)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)methyl]butanoic acid |
| SMILES | CC(=O)NCCN(CCCCc1ccc2c(n1)CCCC2)CC[C@H](Cc1nn(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C30H41N5O3/c1-22(36)31-17-20-35(18-8-7-10-25-15-14-23-9-3-5-12-27(23)32-25)19-16-24(30(37)38)21-28-26-11-4-6-13-29(26)34(2)33-28/h4,6,11,13-15,24H,3,5,7-10,12,16-21H2,1-2H3,(H,31,36)(H,37,38)/t24-/m1/s1 |
| InChIKey | YGIVUJQLIWJYRE-XMMPIXPASA-N |
| XLogP | 3.94 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|