About cyclohexane;2-methylhexane;2-methylpropanal
cyclohexane;2-methylhexane;2-methylpropanal (PubChem CID 160719053) has the molecular formula C17H36O
and a molecular weight of 256.47 g/mol. Its IUPAC name is cyclohexane;2-methylhexane;2-methylpropanal.
Molecular Properties
| Compound Name | cyclohexane;2-methylhexane;2-methylpropanal |
| PubChem CID | 160719053 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | cyclohexane;2-methylhexane;2-methylpropanal |
| SMILES | C1CCCCC1.CC(C)C=O.CCCCC(C)C |
| InChI | InChI=1S/C7H16.C6H12.C4H8O/c1-4-5-6-7(2)3;1-2-4-6-5-3-1;1-4(2)3-5/h7H,4-6H2,1-3H3;1-6H2;3-4H,1-2H3 |
| InChIKey | RSVYTFVSXSLDEC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;2-methylhexane;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-methylhexane;2-methylpropanal?
The IUPAC name of cyclohexane;2-methylhexane;2-methylpropanal (CID 160719053) is cyclohexane;2-methylhexane;2-methylpropanal.
What is the SMILES notation for cyclohexane;2-methylhexane;2-methylpropanal?
The canonical SMILES for cyclohexane;2-methylhexane;2-methylpropanal is C1CCCCC1.CC(C)C=O.CCCCC(C)C.
What is the InChIKey of cyclohexane;2-methylhexane;2-methylpropanal?
The InChIKey is RSVYTFVSXSLDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C6H12.C4H8O/c1-4-5-6-7(2)3;1-2-4-6-5-3-1;1-4(2)3-5/h7H,4-6H2,1-3H3;1-6H2;3-4H,1-2H3.
What are the key properties of cyclohexane;2-methylhexane;2-methylpropanal?
cyclohexane;2-methylhexane;2-methylpropanal has a molecular weight of 256.47 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-methylhexane;2-methylpropanal is sourced from PubChem (CID 160719053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).