C10H14F6 — CID 161144248
ethene;1,1,2-trifluoro-2-methylcyclobutane;1,1,2-trifluoroprop-1-ene (PubChem CID 161144248) has the molecular formula C10H14F6 and a molecular weight of 248.21 g/mol. Its IUPAC name is ethene;1,1,2-trifluoro-2-methylcyclobutane;1,1,2-trifluoroprop-1-ene.
| Compound Name | ethene;1,1,2-trifluoro-2-methylcyclobutane;1,1,2-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 161144248 |
| Molecular Formula | C10H14F6 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethene;1,1,2-trifluoro-2-methylcyclobutane;1,1,2-trifluoroprop-1-ene |
| SMILES | C=C.CC(F)=C(F)F.CC1(F)CCC1(F)F |
| InChI | InChI=1S/C5H7F3.C3H3F3.C2H4/c1-4(6)2-3-5(4,7)8;1-2(4)3(5)6;1-2/h2-3H2,1H3;1H3;1-2H2 |
| InChIKey | UNVNQBUEYBTOFW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|