About ethane;1-phenylpropan-1-ol;bis(yttrium)
ethane;1-phenylpropan-1-ol;bis(yttrium) (PubChem CID 161221036) has the molecular formula C11H17OY2-
and a molecular weight of 343.07 g/mol. Its IUPAC name is ethane;1-phenylpropan-1-ol;bis(yttrium).
Molecular Properties
| Compound Name | ethane;1-phenylpropan-1-ol;bis(yttrium) |
| PubChem CID | 161221036 |
| Molecular Formula | C11H17OY2- |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | ethane;1-phenylpropan-1-ol;bis(yttrium) |
| SMILES | CC.C[CH-]C(O)c1ccccc1.[Y].[Y] |
| InChI | InChI=1S/C9H11O.C2H6.2Y/c1-2-9(10)8-6-4-3-5-7-8;1-2;;/h2-7,9-10H,1H3;1-2H3;;/q-1;;; |
| InChIKey | UVYONADYNXUDGR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-phenylpropan-1-ol;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-phenylpropan-1-ol;bis(yttrium)?
The IUPAC name of ethane;1-phenylpropan-1-ol;bis(yttrium) (CID 161221036) is ethane;1-phenylpropan-1-ol;bis(yttrium).
What is the SMILES notation for ethane;1-phenylpropan-1-ol;bis(yttrium)?
The canonical SMILES for ethane;1-phenylpropan-1-ol;bis(yttrium) is CC.C[CH-]C(O)c1ccccc1.[Y].[Y].
What is the InChIKey of ethane;1-phenylpropan-1-ol;bis(yttrium)?
The InChIKey is UVYONADYNXUDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.C2H6.2Y/c1-2-9(10)8-6-4-3-5-7-8;1-2;;/h2-7,9-10H,1H3;1-2H3;;/q-1;;;.
What are the key properties of ethane;1-phenylpropan-1-ol;bis(yttrium)?
ethane;1-phenylpropan-1-ol;bis(yttrium) has a molecular weight of 343.07 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-phenylpropan-1-ol;bis(yttrium) is sourced from PubChem (CID 161221036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).