C18H23N3O2S — CID 161266048
2,3-dihydro-1H-isoindole-1-sulfonamide;1-ethyl-2,3-dihydroindole (PubChem CID 161266048) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-1-sulfonamide;1-ethyl-2,3-dihydroindole.
| Compound Name | 2,3-dihydro-1H-isoindole-1-sulfonamide;1-ethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 161266048 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-1-sulfonamide;1-ethyl-2,3-dihydroindole |
| SMILES | CCN1CCc2ccccc21.NS(=O)(=O)C1NCc2ccccc21 |
| InChI | InChI=1S/C10H13N.C8H10N2O2S/c1-2-11-8-7-9-5-3-4-6-10(9)11;9-13(11,12)8-7-4-2-1-3-6(7)5-10-8/h3-6H,2,7-8H2,1H3;1-4,8,10H,5H2,(H2,9,11,12) |
| InChIKey | VDEVAOINTHYSPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |