C24H24N2O9 — CID 161325295
benzyl N-(2,5-dioxooxolan-3-yl)carbamate;benzyl N-(5-oxooxolan-3-yl)carbamate (PubChem CID 161325295) has the molecular formula C24H24N2O9 and a molecular weight of 484.46 g/mol. Its IUPAC name is benzyl N-(2,5-dioxooxolan-3-yl)carbamate;benzyl N-(5-oxooxolan-3-yl)carbamate.
| Compound Name | benzyl N-(2,5-dioxooxolan-3-yl)carbamate;benzyl N-(5-oxooxolan-3-yl)carbamate |
|---|---|
| PubChem CID | 161325295 |
| Molecular Formula | C24H24N2O9 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | benzyl N-(2,5-dioxooxolan-3-yl)carbamate;benzyl N-(5-oxooxolan-3-yl)carbamate |
| SMILES | O=C1CC(NC(=O)OCc2ccccc2)C(=O)O1.O=C1CC(NC(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C12H11NO5.C12H13NO4/c14-10-6-9(11(15)18-10)13-12(16)17-7-8-4-2-1-3-5-8;14-11-6-10(8-16-11)13-12(15)17-7-9-4-2-1-3-5-9/h1-5,9H,6-7H2,(H,13,16);1-5,10H,6-8H2,(H,13,15) |
| InChIKey | VKRNLXMQZLNAKR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|