C16H20FNO3 — CID 162010779
1-[(4S,4aR,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]ethanol (PubChem CID 162010779) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-[(4S,4aR,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]ethanol.
| Compound Name | 1-[(4S,4aR,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]ethanol |
|---|---|
| PubChem CID | 162010779 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[(4S,4aR,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]ethanol |
| SMILES | CC1=N[C@](C)(c2ccccc2F)[C@@H]2[C@@H](CO[C@H]2C(C)O)O1 |
| InChI | InChI=1S/C16H20FNO3/c1-9(19)15-14-13(8-20-15)21-10(2)18-16(14,3)11-6-4-5-7-12(11)17/h4-7,9,13-15,19H,8H2,1-3H3/t9?,13-,14-,15+,16-/m1/s1 |
| InChIKey | IBWBCPLRMJJOLB-ALCKUMLWSA-N |
| XLogP | 2.25 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |