C48H54F6O10S2 — CID 162026787
tert-butyl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid (PubChem CID 162026787) has the molecular formula C48H54F6O10S2 and a molecular weight of 969.07 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid.
| Compound Name | tert-butyl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 162026787 |
| Molecular Formula | C48H54F6O10S2 |
| Molecular Weight | 969.07 g/mol |
| Exact Mass | 968.31 |
| IUPAC Name | tert-butyl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate;4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1.O=C(O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H31F3O5S.C22H23F3O5S/c1-24(2,3)34-23(30)25(15-17-33-18-16-25)35(31,32)22-12-10-21(11-13-22)20-8-6-19(7-9-20)5-4-14-26(27,28)29;23-22(24,25)11-1-2-16-3-5-17(6-4-16)18-7-9-19(10-8-18)31(28,29)21(20(26)27)12-14-30-15-13-21/h6-13H,4-5,14-18H2,1-3H3;3-10H,1-2,11-15H2,(H,26,27) |
| InChIKey | YVMIMBTXEPPOBP-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.07 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |