C48H57BBrO18 — CID 162193563
CID 162193563 (PubChem CID 162193563) has the molecular formula C48H57BBrO18 and a molecular weight of 1012.68 g/mol.
| Compound Name | CID 162193563 |
|---|---|
| PubChem CID | 162193563 |
| Molecular Formula | C48H57BBrO18 |
| Molecular Weight | 1012.68 g/mol |
| Exact Mass | 1011.28 |
| IUPAC Name | — |
| SMILES | CC(=O)OCC1OC(Oc2ccc(Br)cc2C)C(OC(C)=O)C(C)C1C.COC(=O)c1cccc(-c2ccc(OC3OC(CO)C(O)C(O)C3O)c(C)c2)c1.COC(=O)c1cccc(O[B]O)c1 |
| InChI | InChI=1S/C21H24O8.C19H25BrO6.C8H8BO4/c1-11-8-13(12-4-3-5-14(9-12)20(26)27-2)6-7-15(11)28-21-19(25)18(24)17(23)16(10-22)29-21;1-10-8-15(20)6-7-16(10)25-19-18(24-14(5)22)12(3)11(2)17(26-19)9-23-13(4)21;1-12-8(10)6-3-2-4-7(5-6)13-9-11/h3-9,16-19,21-25H,10H2,1-2H3;6-8,11-12,17-19H,9H2,1-5H3;2-5,11H,1H3 |
| InChIKey | NIZKZKVCNQHMDM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 252.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|