About 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene
3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene (PubChem CID 162298020) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene |
| PubChem CID | 162298020 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene |
| SMILES | CC(=C1C=CC(C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C15H16/c1-12-8-10-15(11-9-12)13(2)14-6-4-3-5-7-14/h3-12H,1-2H3/b15-13- |
| InChIKey | OMSKIWRROBMEOC-SQFISAMPSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene?
The IUPAC name of 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene (CID 162298020) is 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene.
What is the SMILES notation for 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene?
The canonical SMILES for 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene is CC(=C1C=CC(C)C=C1)c1ccccc1.
What is the InChIKey of 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene?
The InChIKey is OMSKIWRROBMEOC-SQFISAMPSA-N. The full InChI is InChI=1S/C15H16/c1-12-8-10-15(11-9-12)13(2)14-6-4-3-5-7-14/h3-12H,1-2H3/b15-13-.
What are the key properties of 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene?
3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene has a molecular weight of 196.29 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(1-phenylethylidene)cyclohexa-1,4-diene is sourced from PubChem (CID 162298020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).