C26H26F3NO7S — CID 162357046
2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl prop-2-enoate (PubChem CID 162357046) has the molecular formula C26H26F3NO7S and a molecular weight of 553.56 g/mol. Its IUPAC name is 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 162357046 |
| Molecular Formula | C26H26F3NO7S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCSCCOCCn1cc2oc(=O)c(-c3ccccc3C(F)(F)F)cc2cc1=O |
| InChI | InChI=1S/C26H26F3NO7S/c1-2-24(32)36-10-9-35-12-14-38-13-11-34-8-7-30-17-22-18(16-23(30)31)15-20(25(33)37-22)19-5-3-4-6-21(19)26(27,28)29/h2-6,15-17H,1,7-14H2 |
| InChIKey | MPNUMMZQBYDQLG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|