C25H42O6Si — CID 162445768
[(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 162445768) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 162445768 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | [(2S,3S,4E,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-12-oxo-2-[(E)-4-oxobut-2-en-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/C=O)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C25H42O6Si/c1-17-10-12-21(31-32(8,9)25(5,6)7)16-23(28)30-24(19(3)14-15-26)18(2)11-13-22(17)29-20(4)27/h11,13-15,17-18,21-22,24H,10,12,16H2,1-9H3/b13-11+,19-14+/t17-,18-,21+,22-,24-/m0/s1 |
| InChIKey | UAZQXZCQJYNJDU-ZACOKQHWSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|