C4H7F2IO3 — CID 162586330
(2R,3R)-4,4-difluoro-4-iodobutane-1,2,3-triol (PubChem CID 162586330) has the molecular formula C4H7F2IO3 and a molecular weight of 268.00 g/mol. Its IUPAC name is (2R,3R)-4,4-difluoro-4-iodobutane-1,2,3-triol.
| Compound Name | (2R,3R)-4,4-difluoro-4-iodobutane-1,2,3-triol |
|---|---|
| PubChem CID | 162586330 |
| Molecular Formula | C4H7F2IO3 |
| Molecular Weight | 268.00 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | (2R,3R)-4,4-difluoro-4-iodobutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)C(F)(F)I |
| InChI | InChI=1S/C4H7F2IO3/c5-4(6,7)3(10)2(9)1-8/h2-3,8-10H,1H2/t2-,3-/m1/s1 |
| InChIKey | OOUNBGWVEMQWSJ-PWNYCUMCSA-N |
| XLogP | -0.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.00 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|