C6H10F2O6 — CID 141047136
[(2S,4R,5R)-3,3-difluoro-2,4,5,6-tetrahydroxyhexylidene]-oxidooxidanium (PubChem CID 141047136) has the molecular formula C6H10F2O6 and a molecular weight of 216.14 g/mol. Its IUPAC name is [(2S,4R,5R)-3,3-difluoro-2,4,5,6-tetrahydroxyhexylidene]-oxidooxidanium.
| Compound Name | [(2S,4R,5R)-3,3-difluoro-2,4,5,6-tetrahydroxyhexylidene]-oxidooxidanium |
|---|---|
| PubChem CID | 141047136 |
| Molecular Formula | C6H10F2O6 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | [(2S,4R,5R)-3,3-difluoro-2,4,5,6-tetrahydroxyhexylidene]-oxidooxidanium |
| SMILES | [O-]/[O+]=C/[C@H](O)C(F)(F)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H10F2O6/c7-6(8,4(11)2-14-13)5(12)3(10)1-9/h2-5,9-12H,1H2/t3-,4+,5-/m1/s1 |
| InChIKey | OQMXGNWTUISBAI-MROZADKFSA-N |
| XLogP | -3.29 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|