C16H14ClF3N2O2 — CID 162590116
4-chloro-N'-[2-[2-hydroxy-3-(trifluoromethyl)phenyl]ethyl]benzohydrazide (PubChem CID 162590116) has the molecular formula C16H14ClF3N2O2 and a molecular weight of 358.75 g/mol. Its IUPAC name is 4-chloro-N'-[2-[2-hydroxy-3-(trifluoromethyl)phenyl]ethyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[2-hydroxy-3-(trifluoromethyl)phenyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 162590116 |
| Molecular Formula | C16H14ClF3N2O2 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-chloro-N'-[2-[2-hydroxy-3-(trifluoromethyl)phenyl]ethyl]benzohydrazide |
| SMILES | O=C(NNCCc1cccc(C(F)(F)F)c1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O2/c17-12-6-4-11(5-7-12)15(24)22-21-9-8-10-2-1-3-13(14(10)23)16(18,19)20/h1-7,21,23H,8-9H2,(H,22,24) |
| InChIKey | GVROMRQQBMZDMY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|