C6H11BN2O2 — CID 162642370
[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid (PubChem CID 162642370) has the molecular formula C6H11BN2O2 and a molecular weight of 157.00 g/mol. Its IUPAC name is [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid.
| Compound Name | [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 162642370 |
| Molecular Formula | C6H11BN2O2 |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid |
| SMILES | [2H]C([2H])([2H])n1nc(C)c(B(O)O)c1C |
| InChI | InChI=1S/C6H11BN2O2/c1-4-6(7(10)11)5(2)9(3)8-4/h10-11H,1-3H3/i3D3 |
| InChIKey | AWOUMBMZDWJMGM-HPRDVNIFSA-N |
| XLogP | -1.28 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|