[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid

C6H11BN2O2 — CID 162642370

IUPAC[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid
SMILES[2H]C([2H])([2H])n1nc(C)c(B(O)O)c1C
InChIInChI=1S/C6H11BN2O2/c1-4-6(7(10)11)5(2)9(3)8-4/h10-11H,1-3H3/i3D3
InChIKeyAWOUMBMZDWJMGM-HPRDVNIFSA-N
MW157.00 g/mol
LogP-1.28
Rot. Bonds2

About [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid

[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid (PubChem CID 162642370) has the molecular formula C6H11BN2O2 and a molecular weight of 157.00 g/mol. Its IUPAC name is [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid.

Molecular Properties

Compound Name[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid
PubChem CID162642370
Molecular FormulaC6H11BN2O2
Molecular Weight157.00 g/mol
Exact Mass157.11
IUPAC Name[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid
SMILES[2H]C([2H])([2H])n1nc(C)c(B(O)O)c1C
InChIInChI=1S/C6H11BN2O2/c1-4-6(7(10)11)5(2)9(3)8-4/h10-11H,1-3H3/i3D3
InChIKeyAWOUMBMZDWJMGM-HPRDVNIFSA-N
XLogP-1.28
TPSA58.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.00
LogP ≤ 5-1.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid?
The IUPAC name of [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid (CID 162642370) is [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid.
What is the SMILES notation for [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid?
The canonical SMILES for [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid is [2H]C([2H])([2H])n1nc(C)c(B(O)O)c1C.
What is the InChIKey of [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid?
The InChIKey is AWOUMBMZDWJMGM-HPRDVNIFSA-N. The full InChI is InChI=1S/C6H11BN2O2/c1-4-6(7(10)11)5(2)9(3)8-4/h10-11H,1-3H3/i3D3.
What are the key properties of [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid?
[3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid has a molecular weight of 157.00 g/mol, XLogP of -1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-1-(trideuteriomethyl)pyrazol-4-yl]boronic acid is sourced from PubChem (CID 162642370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).